| id | C00015500 |
|---|---|
| Name | CRM 646A |
| CAS RN | 265987-80-2 |
| Standard InChI | InChI=1S/C36H50O13/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-24(48-36-31(41)29(39)30(40)32(49-36)34(44)45)20-26(38)28(22)35(46)47-23-17-21(2)27(33(42)43)25(37)19-23/h17-20,29-32,36-41H,3-16H2,1-2H3,(H,42,43)(H,44,45)/t29-,30-,31?,32?,36+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H50O13/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-24(48-36-31(41)29(39)30(40)32(49-36)34(44)45)20-26(38)28(22)35(46)47-23-17-21(2)27(33(42)43)25(37)19-23/h17-20,29-32,36-41H,3-16H2,1-2H3,(H,42,43)(H,44,45) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1654 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2349240 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Hypocreaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acremonium sp. MT70646 | 5129 | Hypocreaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9Y251 | Heparanase | Enzyme | CHEMBL2349240 |
CHEMBL2349721
(1)
|
0 / 0 |