| id | C00015562 |
|---|---|
| Name | Rhapontigenin / 4'-Methoxy-3,3',5-trihydroxystilbene / (E)-3,3',5-Trihydroxy-4'-methoxystibene |
| CAS RN | 500-65-2 |
| Standard InChI | InChI=1S/C15H14O4/c1-19-15-5-4-10(8-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+ |
| Standard InChI (Main Layer) | InChI=1S/C15H14O4/c1-19-15-5-4-10(8-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 295 |
| By standard InChI | CHEMBL113029 |
|---|---|
| By standard InChI Main Layer | CHEMBL113029 CHEMBL333230 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| Liliopsida | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Gnetaceae | 1 |
| Hyacinthaceae | 1 |
| Anacardiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Gnetum hainanense C.Y.Cheng. | 3380 | Gnetaceae | Spermatophyta | Viridiplantae |
| Rhus pontifica | 4012 | Anacardiaceae | rosids | Viridiplantae |
| Scilla nervosa | 65770 | Hyacinthaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL113029 |
CHEMBL646888
(1)
|
0 / 0 |