| id | C00001559 |
|---|---|
| Name | Albomaculine |
| CAS RN | 668-63-3 |
| Standard InChI | InChI=1S/C19H23NO5/c1-20-8-7-10-5-6-12-14(16(10)20)11-9-13(22-2)17(23-3)18(24-4)15(11)19(21)25-12/h5,9,12,14,16H,6-8H2,1-4H3/t12-,14-,16-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H23NO5/c1-20-8-7-10-5-6-12-14(16(10)20)11-9-13(22-2)17(23-3)18(24-4)15(11)19(21)25-12/h5,9,12,14,16H,6-8H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 715 |
| By standard InChI | CHEMBL250866 |
|---|---|
| By standard InChI Main Layer | CHEMBL250866 |
| By LinkDB | C08515 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Amaryllidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Haemanthus albomaculatus | 39968 | Amaryllidaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL250866 |
CHEMBL925438
(1)
|
1 / 0 |