| id | C00015624 |
|---|---|
| Name | Kynapcin 12 |
| CAS RN | 300661-52-3 |
| Standard InChI | InChI=1S/C22H18O8/c1-11(23)29-21-17(13-3-7-15(25)8-4-13)20(28)22(30-12(2)24)18(19(21)27)14-5-9-16(26)10-6-14/h3-10,25-28H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C22H18O8/c1-11(23)29-21-17(13-3-7-15(25)8-4-13)20(28)22(30-12(2)24)18(19(21)27)14-5-9-16(26)10-6-14/h3-10,25-28H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1526 |
| By standard InChI | CHEMBL515528 |
|---|---|
| By standard InChI Main Layer | CHEMBL515528 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thelephoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Polyozellus multiplex | 281719 | Thelephoraceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNI1 | Chymotrypsin-like elastase family member 1 | S1A | CHEMBL515528 |
CHEMBL1019939
(1)
|
0 / 0 |