| id | C00015662 |
|---|---|
| Name | Phellinsin A |
| CAS RN | 307494-43-5 |
| Standard InChI | InChI=1S/C18H14O8/c19-11-3-1-8(6-13(11)21)5-10-15(17(23)24)16(26-18(10)25)9-2-4-12(20)14(22)7-9/h1-7,15-16,19-22H,(H,23,24)/b10-5+/t15-,16+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H14O8/c19-11-3-1-8(6-13(11)21)5-10-15(17(23)24)16(26-18(10)25)9-2-4-12(20)14(22)7-9/h1-7,15-16,19-22H,(H,23,24) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3407 |
| By standard InChI | CHEMBL1939438 |
|---|---|
| By standard InChI Main Layer | CHEMBL1939438 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Hymenochaetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Phellinus sp. PL3 | 40470 | Hymenochaetaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1939438 |
CHEMBL1943091
(1)
|
0 / 3 |