| id | C00000157 |
|---|---|
| Name | 4-Phenylbutan-2-one |
| CAS RN | 2550-26-7 |
| Standard InChI | InChI=1S/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5516 |
| By standard InChI | CHEMBL1490851 |
|---|---|
| By standard InChI Main Layer | CHEMBL1490851 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia rutifolia | 205374 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1490851 |
CHEMBL1614458
(1)
|
0 / 0 |