| id | C00015732 |
|---|---|
| Name | Fluoroindolocarbazole C |
| CAS RN | 138829-46-6 |
| Standard InChI | InChI=1S/C26H19F2N3O7/c27-8-1-3-12-10(5-8)15-17-18(25(37)30-24(17)36)16-11-6-9(28)2-4-13(11)31(20(16)19(15)29-12)26-23(35)22(34)21(33)14(7-32)38-26/h1-6,14,21-23,26,29,32-35H,7H2,(H,30,36,37)/t14-,21?,22?,23-,26+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H19F2N3O7/c27-8-1-3-12-10(5-8)15-17-18(25(37)30-24(17)36)16-11-6-9(28)2-4-13(11)31(20(16)19(15)29-12)26-23(35)22(34)21(33)14(7-32)38-26/h1-6,14,21-23,26,29,32-35H,7H2,(H,30,36,37) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2063 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL290056 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lechevalieria aerocolonigenes ATCC 39243 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL290056 |
CHEMBL852795
(1)
CHEMBL829186
(1)
|
0 / 0 |