| id | C00015766 |
|---|---|
| Name | Excelsaoctaphenol |
| CAS RN | |
| Standard InChI | InChI=1S/C40H42O8/c1-25(7-17-33-37(45)19-27(20-38(33)46)9-11-29-13-15-31(41)23-35(29)43)5-3-4-6-26(2)8-18-34-39(47)21-28(22-40(34)48)10-12-30-14-16-32(42)24-36(30)44/h7-16,19-24,41-48H,3-6,17-18H2,1-2H3/b11-9+,12-10+,25-7+,26-8+ |
| Standard InChI (Main Layer) | InChI=1S/C40H42O8/c1-25(7-17-33-37(45)19-27(20-38(33)46)9-11-29-13-15-31(41)23-35(29)43)5-3-4-6-26(2)8-18-34-39(47)21-28(22-40(34)48)10-12-30-14-16-32(42)24-36(30)44/h7-16,19-24,41-48H,3-6,17-18H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8784 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chlorophora excelsa | 3487 | Moraceae | rosids | Viridiplantae |