| id | C00016262 |
|---|---|
| Name | Kurasoin B / (+)-Kurasoin B / (S)-3-Hydroxy-4-(1H-indol-3-yl)-1-phenyl-2-butanone |
| CAS RN | 182232-66-2 |
| Standard InChI | InChI=1S/C18H17NO2/c20-17(10-13-6-2-1-3-7-13)18(21)11-14-12-19-16-9-5-4-8-15(14)16/h1-9,12,18-19,21H,10-11H2/t18-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H17NO2/c20-17(10-13-6-2-1-3-7-13)18(21)11-14-12-19-16-9-5-4-8-15(14)16/h1-9,12,18-19,21H,10-11H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4161 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Trichocomaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Paecilomyces sp. FO-3684 | 28568 | Trichocomaceae | Fungi |