| id | C00016595 |
|---|---|
| Name | Phevalin |
| CAS RN | 170713-71-0 |
| Standard InChI | InChI=1S/C14H16N2O/c1-10(2)13-14(17)16-12(9-15-13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,16,17) |
| Standard InChI (Main Layer) | InChI=1S/C14H16N2O/c1-10(2)13-14(17)16-12(9-15-13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,16,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4485 |
| By standard InChI | CHEMBL419498 |
|---|---|
| By standard InChI Main Layer | CHEMBL419498 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. SC433 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07384 | Calpain-1 catalytic subunit | C2 | CHEMBL419498 |
CHEMBL659377
(1)
CHEMBL836134
(1)
|
0 / 0 |