| id | C00016686 |
|---|---|
| Name | Win 66306 |
| CAS RN | 151928-32-4 |
| Standard InChI | InChI=1S/C41H52N8O9/c1-22(2)11-12-24-16-25(13-14-31(24)50)37(54)36-40(57)45-19-32(51)46-29(17-26-18-42-28-9-6-5-8-27(26)28)41(58)49-15-7-10-30(49)38(55)43-20-33(52)47-35(23(3)4)39(56)44-21-34(53)48-36/h5-6,8-9,11,13-14,16,18,23,29-30,35-37,42,50,54H,7,10,12,15,17,19-21H2,1-4H3,(H,43,55)(H,44,56)(H,45,57)(H,46,51)(H,47,52)(H,48,53) |
| Standard InChI (Main Layer) | InChI=1S/C41H52N8O9/c1-22(2)11-12-24-16-25(13-14-31(24)50)37(54)36-40(57)45-19-32(51)46-29(17-26-18-42-28-9-6-5-8-27(26)28)41(58)49-15-7-10-30(49)38(55)43-20-33(52)47-35(23(3)4)39(56)44-21-34(53)48-36/h5-6,8-9,11,13-14,16,18,23,29-30,35-37,42,50,54H,7,10,12,15,17,19-21H2,1-4H3,(H,43,55)(H,44,56)(H,45,57)(H,46,51)(H,47,52)(H,48,53) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7391 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL432228 |
| By LinkDB |
|---|
| By CAS RN | C091110 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aspergillus sp. SC230 | 5052 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL432228 |
CHEMBL750927
(1)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL432228 |
CHEMBL751905
(1)
|
0 / 0 |