| id | C00001679 |
|---|---|
| Name | Ajmaline |
| CAS RN | 4360-12-7 |
| Standard InChI | InChI=1S/C20H26N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-19,23-24H,3,8-9H2,1-2H3/t10-,11-,14-,15-,16?,17-,18+,19+,20+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H26N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-19,23-24H,3,8-9H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 407 |
| By standard InChI | CHEMBL2357792 |
|---|---|
| By standard InChI Main Layer | CHEMBL1434779 CHEMBL1452040 CHEMBL1460192 CHEMBL1515845 CHEMBL1525248 CHEMBL2105617 CHEMBL2356868 CHEMBL2357792 |
| By LinkDB | C06542 |
|---|
| By CAS RN | D000404 |
|---|
| class name | count |
|---|---|
| asterids | 5 |
| family name | count |
|---|---|
| Apocynaceae | 5 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Melodinus balansae | 141584 | Apocynaceae | asterids | Viridiplantae |
| Rauvolfia serpentina | 4060 | Apocynaceae | asterids | Viridiplantae |
| Rauwolfia canescens | 4059 | Apocynaceae | asterids | Viridiplantae |
| Rauwolfia serpentina | 4060 | Apocynaceae | asterids | Viridiplantae |
| Tonduzia longifolia | 141620 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1452040 CHEMBL1515845 CHEMBL2105617 |
CHEMBL1614110
(2)
CHEMBL1741321
(1)
CHEMBL1909136 (2) |
1 / 0 |
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL2105617 |
CHEMBL1909139
(2)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL2105617 |
CHEMBL1909131
(2)
|
0 / 3 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL2105617 |
CHEMBL1909190
(2)
|
2 / 2 |
| P08246 | Neutrophil elastase | S1A | CHEMBL2105617 |
CHEMBL1909195
(2)
|
2 / 1 |
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL2105617 |
CHEMBL1909215
(2)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL2105617 |
CHEMBL1909201
(2)
|
0 / 0 |
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL2105617 |
CHEMBL1909176
(2)
|
0 / 0 |
| P29466 | Caspase-1 | C14 | CHEMBL2105617 |
CHEMBL1909193
(2)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL2105617 |
CHEMBL1909198
(2)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL2105617 |
CHEMBL1909199
(2)
|
0 / 0 |
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL2105617 |
CHEMBL1909197
(2)
|
2 / 2 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1452040 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL2105617 |
CHEMBL1909123
(2)
|
1 / 2 |
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909092
(2)
|
0 / 1 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL2105617 |
CHEMBL1909169
(2)
|
1 / 1 |
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL2105617 |
CHEMBL1909157
(2)
|
0 / 0 |
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL2105617 |
CHEMBL1909156
(2)
|
0 / 0 |
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL2105617 |
CHEMBL1909143
(2)
|
1 / 0 |
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL2105617 |
CHEMBL1909174
(2)
|
0 / 0 |
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909090
(2)
|
0 / 0 |
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909093
(2)
|
0 / 0 |
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL2105617 |
CHEMBL1909127
(2)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL2105617 |
CHEMBL1909204
(2)
|
0 / 0 |
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL2105617 |
CHEMBL1909202
(2)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1515845 CHEMBL2105617 |
CHEMBL1741325
(1)
CHEMBL1909135
(2)
|
0 / 1 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL2105617 |
CHEMBL1909203
(2)
|
1 / 11 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL2105617 |
CHEMBL1909140
(2)
|
2 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL2105617 |
CHEMBL1909130
(2)
|
0 / 0 |
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL2105617 |
CHEMBL1909120
(2)
|
0 / 0 |
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL2105617 |
CHEMBL1909181
(2)
|
0 / 0 |
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL2105617 |
CHEMBL1909164
(2)
|
0 / 0 |
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL2105617 |
CHEMBL1909214
(2)
|
0 / 0 |
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL2105617 |
CHEMBL1909175
(2)
|
0 / 0 |
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL2105617 |
CHEMBL1909096
(2)
|
1 / 1 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL2105617 |
CHEMBL1909118
(2)
|
0 / 0 |
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL2105617 |
CHEMBL1909166
(2)
|
1 / 0 |
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL2105617 |
CHEMBL1909133
(2)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1515845 |
CHEMBL1738606
(1)
|
0 / 0 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL2105617 |
CHEMBL1909158
(2)
|
0 / 0 |
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909088
(2)
|
0 / 0 |
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL2105617 |
CHEMBL1909142
(2)
|
0 / 0 |
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL2105617 |
CHEMBL1909101
(2)
|
0 / 0 |
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL2105617 |
CHEMBL1909141
(2)
|
1 / 0 |
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL2105617 |
CHEMBL1909180
(2)
|
0 / 0 |
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL2105617 |
CHEMBL1909146
(2)
|
0 / 1 |
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL2105617 |
CHEMBL1909104
(2)
|
0 / 0 |
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL2105617 |
CHEMBL1909144
(2)
|
0 / 0 |
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL2105617 |
CHEMBL1909100
(2)
|
0 / 0 |
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL2105617 |
CHEMBL1909167
(2)
|
1 / 0 |
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL2105617 |
CHEMBL1909129
(2)
|
0 / 0 |
| P08311 | Cathepsin G | S1A | CHEMBL2105617 |
CHEMBL1909194
(2)
|
0 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL2105617 |
CHEMBL1909110
(2)
|
1 / 0 |
| P03956 | Interstitial collagenase | M10A | CHEMBL2105617 |
CHEMBL1909196
(2)
|
0 / 1 |
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL2105617 |
CHEMBL1909119
(2)
|
0 / 0 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1460192 |
CHEMBL2114810
(1)
|
7 / 3 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1460192 CHEMBL1525248 |
CHEMBL1614410
(1)
CHEMBL1614531
(1)
|
1 / 3 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL2105617 |
CHEMBL1909150
(2)
|
0 / 1 |
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL2105617 |
CHEMBL1909171
(2)
|
2 / 0 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL2105617 |
CHEMBL1909170
(2)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL2105617 |
CHEMBL1909122
(2)
|
0 / 0 |
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL2105617 |
CHEMBL1909109
(2)
|
2 / 0 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL2105617 |
CHEMBL1909205
(2)
|
5 / 10 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL2105617 |
CHEMBL1909172
(2)
|
1 / 0 |
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL2105617 |
CHEMBL1909114
(2)
|
0 / 0 |
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL2105617 |
CHEMBL1909125
(2)
|
0 / 0 |
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL2105617 |
CHEMBL1909126
(2)
|
3 / 0 |
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL2105617 |
CHEMBL1909108
(2)
|
0 / 0 |
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL2105617 |
CHEMBL1909124
(2)
|
1 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL2105617 |
CHEMBL1909200
(2)
|
0 / 0 |
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL2105617 |
CHEMBL1909207
(2)
|
2 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1515845 CHEMBL2105617 |
CHEMBL1741322
(1)
CHEMBL1909132
(2)
|
0 / 0 |
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL2105617 |
CHEMBL1909186
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL2105617 |
CHEMBL1909145
(2)
|
1 / 1 |
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909091
(2)
|
1 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL2105617 |
CHEMBL1909212
(2)
|
1 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL2105617 |
CHEMBL1909211
(2)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL2105617 |
CHEMBL1909105
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL2105617 |
CHEMBL1909182
(2)
|
0 / 0 |
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL2105617 |
CHEMBL1909173
(2)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL2105617 |
CHEMBL1909113
(2)
|
0 / 0 |
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL2105617 |
CHEMBL1909187
(2)
|
0 / 0 |
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL2105617 |
CHEMBL1909168
(2)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1515845 CHEMBL2105617 |
CHEMBL1741323
(1)
CHEMBL1909134
(2)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1515845 CHEMBL2105617 |
CHEMBL1741324
(1)
CHEMBL1909138
(2)
|
0 / 1 |
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL2105617 |
CHEMBL1909137
(2)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1434779 |
CHEMBL1738184
(1)
|
0 / 0 |
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL2105617 |
CHEMBL1909094
(2)
|
1 / 1 |
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909087
(2)
|
0 / 0 |
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL2105617 |
CHEMBL1909213
(2)
|
0 / 0 |
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL2105617 |
CHEMBL1909089
(2)
|
0 / 0 |
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL2105617 |
CHEMBL1909116
(2)
|
1 / 1 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL2105617 |
CHEMBL1909206
(2)
|
0 / 1 |
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL2105617 |
CHEMBL1909128
(2)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL1525248 |
CHEMBL1614531
(1)
|
2 / 5 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1434779 |
CHEMBL2114738
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D000404 | 3757 |
KCNH2
ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 | Ajmaline results in decreased activity of KCNH2 protein |
decreases activity
|
protein |
15599706
|
| D000404 | 6331 |
SCN5A
CDCD2 CMD1E CMPD2 HB1 HB2 HBBD HH1 ICCD IVF LQT3 Nav1.5 PFHB1 SSS1 VF1 |
sodium channel, voltage-gated, type V, alpha subunit | SCN5A protein affects the susceptibility to Ajmaline |
affects response to substance
|
protein |
10662748
15520322 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #103780 | Alcohol dependence |
P08172
P14416 P31645 |
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 |
Q99720
|
| #602025 | Body mass index quantitative trait locus 9; bmiq9 |
P41968
|
| #300615 | Brunner syndrome |
P21397
|
| #162800 | Cyclic neutropenia |
P08246
|
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 |
P51681
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #615363 | Estrogen resistance; estrr |
P03372
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd |
P24557
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #609423 | Human immunodeficiency virus type 1, susceptibility to |
P41597
P51681 |
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #211980 | Lung cancer |
P00533
P04626 |
| #608516 | Major depressive disorder; mdd |
P08172
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| %300852 | Mental retardation, x-linked 88; mrx88 |
P50052
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #126200 | Multiple sclerosis, susceptibility to; ms |
P08575
|
| #159900 | Myoclonic dystonia |
P14416
|
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 |
P08246
|
| #601665 | Obesity |
P32245
|
| #164230 | Obsessive-compulsive disorder; ocd |
P31645
|
| #604715 | Orthostatic intolerance |
P23975
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #167000 | Ovarian cancer |
P04626
|
| #613135 | Parkinsonism-dystonia, infantile; pkdys |
Q01959
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| #607276 | Resting heart rate, variation in |
P08588
|
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive |
P08575
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #190300 | Tremor, hereditary essential, 1; etm1 |
P35462
|
| #610379 | West nile virus, susceptibility to |
P51681
|
| #112100 | Yt blood group antigen |
P22303
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P35354 (related) |
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P03956 (related) P04626 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00026 | Endometrial Cancer |
P03372
(marker)
P04626 (related) Q92731 (marker) |
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00019 | Pancreatic cancer |
P04626
(related)
|
| H00027 | Ovarian cancer |
P04626
(related)
|
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P35354 (related) |
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00079 | Asthma |
P07550
(related)
|
| H00100 | Neutropenic disorders |
P08246
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P08575
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00025 | Penile cancer |
P14780
(related)
P35354 (related) |
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H01031 | Orthostatic intolerance (OI) |
P23975
(related)
|
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) |
P24557
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
P50052
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D015746 | D000404 | Abdominal Pain |
marker/mechanism
|
3950363
7188270 |
|
| D058186 | D000404 | Acute Kidney Injury |
marker/mechanism
|
4062136
6136033 6219361 |
|
| D000743 | D000404 | Anemia, Hemolytic |
marker/mechanism
|
4062136
6219361 |
|
| D001002 | D000404 | Anuria |
marker/mechanism
|
673706
4062136 |
|
| D001145 | D000404 | Arrhythmias, Cardiac |
therapeutic
|
11153
612098 3390652 11565214 |
|
| D001281 | D000404 | Atrial Fibrillation |
marker/mechanism
|
19589796
|
|
| D054537 | D000404 | Atrioventricular Block |
marker/mechanism
|
52953
3570558 3943926 6418092 8056216 8287634 |
|
| C535438 | D000404 | Bidirectional tachycardia |
marker/mechanism
|
2605577
|
|
| D053840 | D000404 | Brugada Syndrome |
marker/mechanism
|
17098780
|
|
| D002037 | D000404 | Bundle-Branch Block |
marker/mechanism
|
5586389
|
|
| D023341 | D000404 | Chills |
marker/mechanism
|
3950363
7188270 |
|
| D002779 | D000404 | Cholestasis |
marker/mechanism
|
732373
2568014 3950363 4062136 7188270 |
|
| D002780 | D000404 | Cholestasis, Intrahepatic |
marker/mechanism
|
5124256
|
|
| D004342 | D000404 | Drug Hypersensitivity |
marker/mechanism
|
673706
4062136 6219361 |
|
| D056486 | D000404 | Drug-Induced Liver Injury |
marker/mechanism
|
732373
3950363 6873568 |
|
| D056487 | D000404 | Drug-Induced Liver Injury, Chronic |
marker/mechanism
|
2568014
|
|
| D064420 | D000404 | Drug-Related Side Effects and Adverse Reactions |
marker/mechanism
|
5006193
|
|
| D004802 | D000404 | Eosinophilia |
marker/mechanism
|
7188270
|
|
| D005334 | D000404 | Fever |
marker/mechanism
|
2568014
3950363 7188270 |
|
| D006461 | D000404 | Hemolysis |
marker/mechanism
|
4062136
|
|
| D006505 | D000404 | Hepatitis |
marker/mechanism
|
4029887
|
|
| D007565 | D000404 | Jaundice |
marker/mechanism
|
673706
2568014 3950363 4062136 5124256 6873568 7188270 |
|
| D009461 | D000404 | Neurologic Manifestations |
marker/mechanism
|
858468
|
|
| D011537 | D000404 | Pruritus |
marker/mechanism
|
7188270
|
|
| D013611 | D000404 | Tachycardia, Atrioventricular Nodal Reentry |
marker/mechanism
|
1737670
|
|
| D013617 | D000404 | Tachycardia, Supraventricular |
marker/mechanism
|
1737670
2515824 |
|
| D017180 | D000404 | Tachycardia, Ventricular |
marker/mechanism
therapeutic |
1505562
10750146 15599706 18599870 19897501 |
|
| D013921 | D000404 | Thrombocytopenia |
marker/mechanism
|
673706
4062136 |
|
| D016171 | D000404 | Torsades de Pointes |
marker/mechanism
|
3948201
3995518 11565214 |
|
| D014693 | D000404 | Ventricular Fibrillation |
marker/mechanism
therapeutic |
2028554
18599870 19589796 19897501 |
|
| D018879 | D000404 | Ventricular Premature Complexes |
therapeutic
|
11153
|
|
| D014973 | D000404 | Xanthomatosis |
marker/mechanism
|
5124256
|