| id | C00016853 |
|---|---|
| Name | HC 34 / Vicenistatin / Vicenistatine |
| CAS RN | 150999-05-6 |
| Standard InChI | InChI=1S/C30H48N2O4/c1-21-12-8-7-9-13-23(3)20-32-28(34)15-11-10-14-24(4)27(17-16-22(2)18-21)36-29-19-26(33)30(31-6)25(5)35-29/h7-8,10-12,14-16,23-27,29-31,33H,9,13,17-20H2,1-6H3,(H,32,34)/b8-7+,14-10+,15-11+,21-12-,22-16-/t23-,24-,25?,26+,27-,29-,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H48N2O4/c1-21-12-8-7-9-13-23(3)20-32-28(34)15-11-10-14-24(4)27(17-16-22(2)18-21)36-29-19-26(33)30(31-6)25(5)35-29/h7-8,10-12,14-16,23-27,29-31,33H,9,13,17-20H2,1-6H3,(H,32,34) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5642 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1593623 CHEMBL1797115 CHEMBL1970022 |
| By LinkDB | C15688 |
|---|
| By CAS RN | C082785 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. HC34 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1593623 |
CHEMBL1613777
(1)
|
1 / 1 |