| id | C00001686 |
|---|---|
| Name | Antirhine |
| CAS RN | 16049-28-8 |
| Standard InChI | InChI=1S/C19H24N2O/c1-2-13(12-22)14-7-9-21-10-8-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14/h2-6,13-14,18,20,22H,1,7-12H2/t13-,14-,18-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H24N2O/c1-2-13(12-22)14-7-9-21-10-8-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14/h2-6,13-14,18,20,22H,1,7-12H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1226 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL194463 |
| By LinkDB | C09033 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| family name | count |
|---|---|
| Apocynaceae | 2 |
| Rubiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Antirhea putaminosa | 43445 | Rubiaceae | asterids | Viridiplantae |
| Catharanthus longifolius | 1167199 | Apocynaceae | asterids | Viridiplantae |
| Rhazya stricta | 396313 | Apocynaceae | asterids | Viridiplantae |