id | C00001702 |
---|---|
Name | Caracurine V |
CAS RN | 630-87-5 |
Standard InChI | InChI=1S/C38H40N4O2/c1-3-7-27-25(5-1)37-11-13-39-19-21-10-16-44-36-31(23(21)17-29(37)39)33(37)41(27)35-32-24-18-30-38(12-14-40(30)20-22(24)9-15-43-35)26-6-2-4-8-28(26)42(36)34(32)38/h1-10,23-24,29-36H,11-20H2/t23-,24-,29-,30-,31+,32+,33-,34-,35+,36+,37+,38+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C38H40N4O2/c1-3-7-27-25(5-1)37-11-13-39-19-21-10-16-44-36-31(23(21)17-29(37)39)33(37)41(27)35-32-24-18-30-38(12-14-40(30)20-22(24)9-15-43-35)26-6-2-4-8-28(26)42(36)34(32)38/h1-10,23-24,29-36H,11-20H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1935 |
By standard InChI | CHEMBL380352 |
---|---|
By standard InChI Main Layer | CHEMBL312920 CHEMBL380352 |
By LinkDB | C09100 |
---|
By CAS RN | C041536 |
---|
class name | count |
---|---|
asterids | 2 |
family name | count |
---|---|
Loganiaceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Strychnos dolichothyrsa | 26496 | Loganiaceae | asterids | Viridiplantae |
Strychnos toxifera | 1040935 | Loganiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL380352 |
CHEMBL861240
(1)
|
2 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#103780 | Alcohol dependence |
P08172
|
#608516 | Major depressive disorder; mdd |
P08172
|