| id | C00017126 |
|---|---|
| Name | Okicenone |
| CAS RN | 137018-54-3 |
| Standard InChI | InChI=1S/C15H14O4/c1-7-4-9(16)5-8-6-10-11(17)2-3-12(18)14(10)15(19)13(7)8/h4-6,11,16-17,19H,2-3H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H14O4/c1-7-4-9(16)5-8-6-10-11(17)2-3-12(18)14(10)15(19)13(7)8/h4-6,11,16-17,19H,2-3H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2869 |
| By standard InChI | CHEMBL1240971 |
|---|---|
| By standard InChI Main Layer | CHEMBL1240971 |
| By LinkDB |
|---|
| By CAS RN | C071011 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. KO-3599 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q15717 | ELAV-like protein 1 | Unclassified protein | CHEMBL1240971 |
CHEMBL1243887
(2)
CHEMBL1243901
(1)
|
0 / 0 |