id | C00017203 |
---|---|
Name | WS 7338A / BE 18257A |
CAS RN | 136553-73-6 |
Standard InChI | InChI=1S/C30H42N6O7/c1-15(2)12-22-28(41)34-23(13-18-14-31-20-9-7-6-8-19(18)20)29(42)33-21(10-11-24(37)38)27(40)32-17(5)26(39)36-25(16(3)4)30(43)35-22/h6-9,14-17,21-23,25,31H,10-13H2,1-5H3,(H,32,40)(H,33,42)(H,34,41)(H,35,43)(H,36,39)(H,37,38)/t17-,21+,22-,23+,25+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C30H42N6O7/c1-15(2)12-22-28(41)34-23(13-18-14-31-20-9-7-6-8-19(18)20)29(42)33-21(10-11-24(37)38)27(40)32-17(5)26(39)36-25(16(3)4)30(43)35-22/h6-9,14-17,21-23,25,31H,10-13H2,1-5H3,(H,32,40)(H,33,42)(H,34,41)(H,35,43)(H,36,39)(H,37,38) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1637 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL432683 CHEMBL69761 CHEMBL335588 CHEMBL137325 CHEMBL137687 |
By LinkDB |
---|
By CAS RN | C072732 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces misakiensis | 67330 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24530 | Endothelin B receptor | Endothelin receptor | CHEMBL69761 |
CHEMBL670731
(1)
|
4 / 4 |