id | C00017204 |
---|---|
Name | WS 7338B / BE 18257B |
CAS RN | 136553-74-7 |
Standard InChI | InChI=1S/C31H44N6O7/c1-6-17(4)26-31(44)36-23(13-16(2)3)29(42)35-24(14-19-15-32-21-10-8-7-9-20(19)21)30(43)34-22(11-12-25(38)39)28(41)33-18(5)27(40)37-26/h7-10,15-18,22-24,26,32H,6,11-14H2,1-5H3,(H,33,41)(H,34,43)(H,35,42)(H,36,44)(H,37,40)(H,38,39)/t17-,18-,22+,23-,24+,26+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C31H44N6O7/c1-6-17(4)26-31(44)36-23(13-16(2)3)29(42)35-24(14-19-15-32-21-10-8-7-9-20(19)21)30(43)34-22(11-12-25(38)39)28(41)33-18(5)27(40)37-26/h7-10,15-18,22-24,26,32H,6,11-14H2,1-5H3,(H,33,41)(H,34,43)(H,35,42)(H,36,44)(H,37,40)(H,38,39) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1637 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL343379 CHEMBL1790499 |
By LinkDB |
---|
By CAS RN | C069764 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces misakiensis | 67330 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24530 | Endothelin B receptor | Endothelin receptor | CHEMBL343379 CHEMBL1790499 |
CHEMBL672254
(1)
CHEMBL670731
(1)
|
4 / 4 |
P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL343379 |
CHEMBL682971
(1)
|
0 / 0 |