| id | C00017538 |
|---|---|
| Name | Maggiemycin |
| CAS RN | 81341-47-1 |
| Standard InChI | InChI=1S/C22H18O9/c1-3-22(30)7-10(24)12-13(16(22)21(29)31-2)20(28)14-15(19(12)27)18(26)11-8(17(14)25)5-4-6-9(11)23/h4-6,16,23,27-28,30H,3,7H2,1-2H3/t16-,22+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H18O9/c1-3-22(30)7-10(24)12-13(16(22)21(29)31-2)20(28)14-15(19(12)27)18(26)11-8(17(14)25)5-4-6-9(11)23/h4-6,16,23,27-28,30H,3,7H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1296 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL388565 |
| By LinkDB |
|---|
| By CAS RN | C061866 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces ATCC No. 39235 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17301 | Integrin alpha-2 | Unclassified protein | CHEMBL388565 |
CHEMBL905713
(1)
|
0 / 0 |