id | C00017539 |
---|---|
Name | Anhydromaggiemycin |
CAS RN | 91432-49-4 |
Standard InChI | InChI=1S/C22H16O8/c1-3-8-7-11(24)14-15(12(8)22(29)30-2)21(28)16-17(20(14)27)19(26)13-9(18(16)25)5-4-6-10(13)23/h4-7,23-24,27-28H,3H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C22H16O8/c1-3-8-7-11(24)14-15(12(8)22(29)30-2)21(28)16-17(20(14)27)19(26)13-9(18(16)25)5-4-6-10(13)23/h4-7,23-24,27-28H,3H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 921 |
By standard InChI | CHEMBL226282 |
---|---|
By standard InChI Main Layer | CHEMBL226282 |
By LinkDB |
---|
By CAS RN | C061867 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces ATCC No. 39235 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P17301 | Integrin alpha-2 | Unclassified protein | CHEMBL226282 |
CHEMBL905713
(1)
|
0 / 0 |