| id | C00017539 |
|---|---|
| Name | Anhydromaggiemycin |
| CAS RN | 91432-49-4 |
| Standard InChI | InChI=1S/C22H16O8/c1-3-8-7-11(24)14-15(12(8)22(29)30-2)21(28)16-17(20(14)27)19(26)13-9(18(16)25)5-4-6-10(13)23/h4-7,23-24,27-28H,3H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C22H16O8/c1-3-8-7-11(24)14-15(12(8)22(29)30-2)21(28)16-17(20(14)27)19(26)13-9(18(16)25)5-4-6-10(13)23/h4-7,23-24,27-28H,3H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 921 |
| By standard InChI | CHEMBL226282 |
|---|---|
| By standard InChI Main Layer | CHEMBL226282 |
| By LinkDB |
|---|
| By CAS RN | C061867 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces ATCC No. 39235 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17301 | Integrin alpha-2 | Unclassified protein | CHEMBL226282 |
CHEMBL905713
(1)
|
0 / 0 |