| id | C00017657 |
|---|---|
| Name | Kinamycin F |
| CAS RN | 50556-18-8 |
| Standard InChI | InChI=1S/C18H14N2O7/c1-18(27)16(25)11-9(15(24)17(18)26)8-10(12(11)20-19)14(23)7-5(13(8)22)3-2-4-6(7)21/h2-4,15-17,21,24-27H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H14N2O7/c1-18(27)16(25)11-9(15(24)17(18)26)8-10(12(11)20-19)14(23)7-5(13(8)22)3-2-4-6(7)21/h2-4,15-17,21,24-27H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 683 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN | C059021 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces murayamaensis sp. nov. Hata et Ohtani | 1883 | Streptomycetaceae | Bacteria |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C059021 | 896 |
CCND3
|
cyclin D3 | kinamycin F results in decreased expression of CCND3 mRNA |
decreases expression
|
mRNA |
20079721
|
| C059021 | 896 |
CCND3
|
cyclin D3 | kinamycin F results in decreased expression of CCND3 protein |
decreases expression
|
protein |
20079721
|