| id | C00018021 |
|---|---|
| Name | Siastatin B |
| CAS RN | 54795-58-3 |
| Standard InChI | InChI=1S/C8H14N2O5/c1-3(11)10-7-6(13)5(12)4(2-9-7)8(14)15/h4-7,9,12-13H,2H2,1H3,(H,10,11)(H,14,15)/t4-,5-,6-,7+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C8H14N2O5/c1-3(11)10-7-6(13)5(12)4(2-9-7)8(14)15/h4-7,9,12-13H,2H2,1H3,(H,10,11)(H,14,15) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6187 |
| By standard InChI | CHEMBL201657 |
|---|---|
| By standard InChI Main Layer | CHEMBL201657 CHEMBL2349239 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces verticillus var. quintum | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9Y251 | Heparanase | Enzyme | CHEMBL2349239 |
CHEMBL2349721
(1)
|
0 / 0 |