id | C00018029 |
---|---|
Name | Antibiotic TL 119 |
CAS RN | 55599-68-3 |
Standard InChI | InChI=1S/C42H57N7O9/c1-9-30-42(57)58-26(7)35(41(56)48-34(24(4)5)40(55)43-25(6)36(51)45-30)49-39(54)33(22-29-18-14-11-15-19-29)47-37(52)31(20-23(2)3)46-38(53)32(44-27(8)50)21-28-16-12-10-13-17-28/h9-19,23-26,31-35H,20-22H2,1-8H3,(H,43,55)(H,44,50)(H,45,51)(H,46,53)(H,47,52)(H,48,56)(H,49,54)/b30-9+ |
Standard InChI (Main Layer) | InChI=1S/C42H57N7O9/c1-9-30-42(57)58-26(7)35(41(56)48-34(24(4)5)40(55)43-25(6)36(51)45-30)49-39(54)33(22-29-18-14-11-15-19-29)47-37(52)31(20-23(2)3)46-38(53)32(44-27(8)50)21-28-16-12-10-13-17-28/h9-19,23-26,31-35H,20-22H2,1-8H3,(H,43,55)(H,44,50)(H,45,51)(H,46,53)(H,47,52)(H,48,56)(H,49,54) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1425 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1784747 |
By LinkDB |
---|
By CAS RN | C006475 |
---|
class name | count |
---|
family name | count |
---|---|
Bacillaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Bacillus sp. TL-119 | 186817 | Bacillaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q8NER1 | Transient receptor potential cation channel subfamily V member 1 | TRPV (Vanilloid) | CHEMBL1784747 |
CHEMBL1786675
(1)
|
0 / 0 |