| id | C00018064 |
|---|---|
| Name | NSC 139979 / L-threo-3-Hydroxyaspartic acid / L-threo-beta-Hydroxyaspartic acid |
| CAS RN | 7298-99-9 |
| Standard InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5453 |
| By standard InChI | CHEMBL1231330 |
|---|---|
| By standard InChI Main Layer | CHEMBL568192 CHEMBL1231330 CHEMBL1256517 CHEMBL1356625 |
| By LinkDB | C11511 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Apiosporaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arthrinium phaeospermum T-53 | 112177 | Apiosporaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1231330 |
CHEMBL1741321
(1)
|
1 / 0 |
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1231330 |
CHEMBL1738600
(1)
|
0 / 0 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1231330 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1231330 |
CHEMBL1741325
(1)
|
0 / 1 |
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL1231330 |
CHEMBL1614522
(1)
CHEMBL1614067
(1)
|
1 / 2 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1231330 CHEMBL1356625 |
CHEMBL1614458
(2)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1231330 |
CHEMBL1738606
(1)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL1231330 |
CHEMBL1794467
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1231330 |
CHEMBL1741322
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1231330 |
CHEMBL1738675
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1231330 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1231330 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
CHEMBL1741324 (1) |
0 / 1 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1231330 |
CHEMBL1613914
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1231330 |
CHEMBL1738442
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #210900 | Bloom syndrome; blm |
P54132
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00094 | DNA repair defects |
P54132
(related)
|
| H00296 | Defects in RecQ helicases |
P54132
(related)
|