id | C00018076 |
---|---|
Name | Neothramycin A / (+)-Neothramycin A |
CAS RN | 59593-16-7 |
Standard InChI | InChI=1S/C13H14N2O4/c1-19-11-4-8-9(5-10(11)16)14-6-7-2-3-12(17)15(7)13(8)18/h4-7,12,16-17H,2-3H2,1H3/t7-,12-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C13H14N2O4/c1-19-11-4-8-9(5-10(11)16)14-6-7-2-3-12(17)15(7)13(8)18/h4-7,12,16-17H,2-3H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3795 |
By standard InChI | CHEMBL508445 |
---|---|
By standard InChI Main Layer | CHEMBL508445 |
By LinkDB |
---|
By CAS RN | C030005 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces No. MC916-C4 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL508445 |
CHEMBL965573
(1)
|
1 / 1 |