| id | C00018077 |
|---|---|
| Name | Neothramycin B / (+)-Neothramycin B |
| CAS RN | 59593-15-6 |
| Standard InChI | InChI=1S/C13H14N2O4/c1-19-11-4-8-9(5-10(11)16)14-6-7-2-3-12(17)15(7)13(8)18/h4-7,12,16-17H,2-3H2,1H3/t7-,12+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C13H14N2O4/c1-19-11-4-8-9(5-10(11)16)14-6-7-2-3-12(17)15(7)13(8)18/h4-7,12,16-17H,2-3H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3795 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL508445 |
| By LinkDB |
|---|
| By CAS RN | C030006 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces No. MC916-C4 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL508445 |
CHEMBL965573
(1)
|
1 / 1 |