| id | C00018212 |
|---|---|
| Name | Thienamycin / (+)-Thienamycin |
| CAS RN | 59995-64-1 |
| Standard InChI | InChI=1S/C11H16N2O4S/c1-5(14)8-6-4-7(18-3-2-12)9(11(16)17)13(6)10(8)15/h5-6,8,14H,2-4,12H2,1H3,(H,16,17)/t5-,6-,8-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H16N2O4S/c1-5(14)8-6-4-7(18-3-2-12)9(11(16)17)13(6)10(8)15/h5-6,8,14H,2-4,12H2,1H3,(H,16,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 954 |
| By standard InChI | CHEMBL278773 |
|---|---|
| By standard InChI Main Layer | CHEMBL278773 |
| By LinkDB | C06664 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces MA4297 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16444 | Dipeptidase 1 | M19 | CHEMBL278773 |
CHEMBL664506
(1)
|
0 / 0 |