id | C00018476 |
---|---|
Name | NSC 335651 / Ebelactone B / (-)-Ebelactone B |
CAS RN | 76808-15-6 |
Standard InChI | InChI=1S/C21H36O4/c1-8-13(4)18(22)16(7)19(23)14(5)10-12(3)11-15(6)20-17(9-2)21(24)25-20/h10,13-18,20,22H,8-9,11H2,1-7H3/b12-10+/t13-,14-,15+,16+,17+,18-,20+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H36O4/c1-8-13(4)18(22)16(7)19(23)14(5)10-12(3)11-15(6)20-17(9-2)21(24)25-20/h10,13-18,20,22H,8-9,11H2,1-7H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5136 |
By standard InChI | CHEMBL1905558 |
---|---|
By standard InChI Main Layer | CHEMBL1905558 |
By LinkDB |
---|
By CAS RN | C030795 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces sp. MG7-G1 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1905558 |
CHEMBL1794536
(1)
|
0 / 0 |