| id | C00018476 |
|---|---|
| Name | NSC 335651 / Ebelactone B / (-)-Ebelactone B |
| CAS RN | 76808-15-6 |
| Standard InChI | InChI=1S/C21H36O4/c1-8-13(4)18(22)16(7)19(23)14(5)10-12(3)11-15(6)20-17(9-2)21(24)25-20/h10,13-18,20,22H,8-9,11H2,1-7H3/b12-10+/t13-,14-,15+,16+,17+,18-,20+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H36O4/c1-8-13(4)18(22)16(7)19(23)14(5)10-12(3)11-15(6)20-17(9-2)21(24)25-20/h10,13-18,20,22H,8-9,11H2,1-7H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5136 |
| By standard InChI | CHEMBL1905558 |
|---|---|
| By standard InChI Main Layer | CHEMBL1905558 |
| By LinkDB |
|---|
| By CAS RN | C030795 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. MG7-G1 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1905558 |
CHEMBL1794536
(1)
|
0 / 0 |