| id | C00018662 |
|---|---|
| Name | Gancidin W / Maculosin 6 / L-Leucyl-L-proline lactam |
| CAS RN | 2873-36-1 |
| Standard InChI | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2153 |
| By standard InChI | CHEMBL508326 |
|---|---|
| By standard InChI Main Layer | CHEMBL460331 CHEMBL460767 CHEMBL463718 CHEMBL508326 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces No. AAK-84 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL508326 |
CHEMBL941113
(1)
|
0 / 0 |