| id | C00018678 |
|---|---|
| Name | Gutolactone / 1,6-Dihydroxyphenazine |
| CAS RN | 69-48-7 |
| Standard InChI | InChI=1S/C12H8N2O2/c15-9-5-1-3-7-11(9)14-8-4-2-6-10(16)12(8)13-7/h1-6,15-16H |
| Standard InChI (Main Layer) | InChI=1S/C12H8N2O2/c15-9-5-1-3-7-11(9)14-8-4-2-6-10(16)12(8)13-7/h1-6,15-16H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3213 |
| By standard InChI | CHEMBL2071426 |
|---|---|
| By standard InChI Main Layer | CHEMBL2071426 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces thioluteus M 6-62 n | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL2071426 |
CHEMBL2072352
(1)
|
1 / 0 |