id | C00018725 |
---|---|
Name | Laurusin / Ohyamycin / NSC 106486 / Formycin B |
CAS RN | 13877-76-4 |
Standard InChI | InChI=1S/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7+,8?,9+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4102 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL267525 CHEMBL602747 CHEMBL603183 |
By LinkDB |
---|
By CAS RN | C034561 |
---|
class name | count |
---|
family name | count |
---|---|
Nocardiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Nocardia interforma | 1311814 | Nocardiaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00491 | Purine nucleoside phosphorylase | Enzyme | CHEMBL602747 CHEMBL603183 |
CHEMBL760481
(1)
CHEMBL760484
(1)
CHEMBL766696 (1) CHEMBL1072376 (1) |
1 / 1 |