| id | C00018726 |
|---|---|
| Name | PN / Pyroace / NSC 107654 / NSC 637277 / Pyrrolnitrin / Pyrrolnitrine |
| CAS RN | 1018-71-9 |
| Standard InChI | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| Standard InChI (Main Layer) | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7341 |
| By standard InChI | CHEMBL97972 |
|---|---|
| By standard InChI Main Layer | CHEMBL97972 |
| By LinkDB | C12491 |
|---|
| By CAS RN | D011764 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Pseudomonadaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pseudomonas pyrrocinia No. 2327 | 286 | Pseudomonadaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL97972 |
CHEMBL2114843
(1)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL97972 |
CHEMBL1794467
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL97972 |
CHEMBL1738442
(1)
|
0 / 0 |