id | C00018826 |
---|---|
Name | Prumycin |
CAS RN | 38819-28-2 |
Standard InChI | InChI=1S/C8H17N3O4/c1-4(9)8(15)11-6(3-13)7(14)5(10)2-12/h2,4-7,13-14H,3,9-10H2,1H3,(H,11,15)/t4-,5+,6+,7-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C8H17N3O4/c1-4(9)8(15)11-6(3-13)7(14)5(10)2-12/h2,4-7,13-14H,3,9-10H2,1H3,(H,11,15) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7127 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1718227 CHEMBL2007816 |
By LinkDB |
---|
By CAS RN | C025517 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces No. F-1028 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1718227 |
CHEMBL1794584
(1)
|
2 / 0 |
P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1718227 |
CHEMBL2114788
(1)
|
0 / 0 |
Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1718227 |
CHEMBL1738184
(1)
|
0 / 0 |
Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL1718227 |
CHEMBL2354301
(1)
|
1 / 2 |