| id | C00018908 |
|---|---|
| Name | Laurentiquinone / 3',6'-Diketo-7-hydroxy-8,2',4'-trimethoxyisoflavan |
| CAS RN | 21140-88-5 |
| Standard InChI | InChI=1S/C18H18O7/c1-22-13-7-12(20)14(18(24-3)15(13)21)10-6-9-4-5-11(19)17(23-2)16(9)25-8-10/h4-5,7,10,19H,6,8H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H18O7/c1-22-13-7-12(20)14(18(24-3)15(13)21)10-6-9-4-5-11(19)17(23-2)16(9)25-8-10/h4-5,7,10,19H,6,8H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 517 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Millettia laurentii | 53625 | Fabaceae | rosids | Viridiplantae |