| id | C00018910 |
|---|---|
| Name | Arizonicanol A |
| CAS RN | 213130-75-7 |
| Standard InChI | InChI=1S/C16H16O5/c1-20-13-5-4-12(15(18)16(13)19)10-6-9-2-3-11(17)7-14(9)21-8-10/h2-5,7,10,17-19H,6,8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H16O5/c1-20-13-5-4-12(15(18)16(13)19)10-6-9-2-3-11(17)7-14(9)21-8-10/h2-5,7,10,17-19H,6,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 73 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL592625 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calia arizonica | 247907 | Fabaceae | rosids | Viridiplantae |
| Sophora arizonica | 247907 | Fabaceae | rosids | Viridiplantae |
| Sophora gypsophila | 3896 | Fabaceae | rosids | Viridiplantae |
| Sophora secundiflora | 48122 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL592625 |
CHEMBL1068398
(1)
|
5 / 3 |