| id | C00019023 |
|---|---|
| Name | 5,2'-Dimethoxy-6,7:4',5'-bis(methylenedioxy)isoflavone |
| CAS RN | 499242-09-0 |
| Standard InChI | InChI=1S/C19H14O8/c1-21-11-4-13-12(24-7-25-13)3-9(11)10-6-23-14-5-15-18(27-8-26-15)19(22-2)16(14)17(10)20/h3-6H,7-8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H14O8/c1-21-11-4-13-12(24-7-25-13)3-9(11)10-6-23-14-5-15-18(27-8-26-15)19(22-2)16(14)17(10)20/h3-6H,7-8H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 27 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ateleia herbert-smithii | 53831 | Fabaceae | rosids | Viridiplantae |