| id | C00019309 | 
|---|---|
| Name | Moracin M / Veraphenol / 6,3',5'-Trihydroxy-2-phenylbenzofuran | 
| CAS RN | 56317-21-6 | 
| Standard InChI | InChI=1S/C14H10O4/c15-10-2-1-8-5-13(18-14(8)7-10)9-3-11(16)6-12(17)4-9/h1-7,15-17H | 
| Standard InChI (Main Layer) | InChI=1S/C14H10O4/c15-10-2-1-8-5-13(18-14(8)7-10)9-3-11(16)6-12(17)4-9/h1-7,15-17H | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 71 | 
| By standard InChI | CHEMBL512578 | 
|---|---|
| By standard InChI Main Layer | CHEMBL512578 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 3 | 
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Moraceae | 3 | 
| Smilacaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Artocarpus dadah | 709041 | Moraceae | rosids | Viridiplantae | 
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae | 
| Morus insignis | 1031565 | Moraceae | rosids | Viridiplantae | 
| Smilax bracteata | 1045134 | Smilacaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL512578 | CHEMBL1020816
                        (1) | 0 / 3 | 
| Q08499 | cAMP-specific 3',5'-cyclic phosphodiesterase 4D | PDE_4D | CHEMBL512578 | CHEMBL2019709
                        (1) | 1 / 0 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL512578 | CHEMBL1020815
                        (1) | 0 / 0 | 
| Q07343 | cAMP-specific 3',5'-cyclic phosphodiesterase 4B | PDE_4B | CHEMBL512578 | CHEMBL2019710
                        (1) | 0 / 0 | 
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL512578 | CHEMBL1794495
                        (1) | 2 / 2 | 
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL512578 | CHEMBL949646
                        (1) | 2 / 2 | 
| O76083 | High affinity cGMP-specific 3',5'-cyclic phosphodiesterase 9A | PDE_9A | CHEMBL512578 | CHEMBL2019712
                        (1) | 0 / 0 | 
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL512578 | CHEMBL2019711
                        (1) | 0 / 0 | 
| Q9H0H5 | Rac GTPase-activating protein 1 | Unclassified protein | CHEMBL512578 | CHEMBL2114881
                        (1) | 0 / 0 | 
| Q9HCT0 | Fibroblast growth factor 22 | Unclassified protein | CHEMBL512578 | CHEMBL2354256
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #614613 | Acrodysostosis 2, with or without hormone resistance; acrdys2 | Q08499 | 
| #613546 | Aromatase deficiency | P11511 | 
| #139300 | Aromatase excess syndrome; aexs | P11511 | 
| #257200 | Niemann-pick disease, type a | P17405 | 
| #607616 | Niemann-pick disease, type b | P17405 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) | P11511
                            (related) | 
| H00794 | Aromatase excess syndrome | P11511
                            (related) | 
| H00137 | Niemann-Pick disease (NPD) typeA and B | P17405
                            (related) | 
| H00424 | Defects in the degradation of sphingomyelin | P17405
                            (related) | 
| H00017 | Esophageal cancer | P35354
                            (related) | 
| H00025 | Penile cancer | P35354
                            (related) | 
| H00046 | Cholangiocarcinoma | P35354
                            (related) |