| id | C00019677 |
|---|---|
| Name | 2-Oxoisocaproate / 4-Methyl-2-oxopentanoic acid |
| CAS RN | 816-66-0 |
| Standard InChI | InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
| Standard InChI (Main Layer) | InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5279 |
| By standard InChI | CHEMBL445647 |
|---|---|
| By standard InChI Main Layer | CHEMBL445647 CHEMBL2074692 |
| By LinkDB | C00233 |
|---|
| By CAS RN | C013082 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL2074692 |
CHEMBL2076227
(1)
|
0 / 0 |