id | C00019677 |
---|---|
Name | 2-Oxoisocaproate / 4-Methyl-2-oxopentanoic acid |
CAS RN | 816-66-0 |
Standard InChI | InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
Standard InChI (Main Layer) | InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5279 |
By standard InChI | CHEMBL445647 |
---|---|
By standard InChI Main Layer | CHEMBL445647 CHEMBL2074692 |
By LinkDB | C00233 |
---|
By CAS RN | C013082 |
---|
class name | count |
---|
family name | count |
---|---|
Enterobacteriaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL2074692 |
CHEMBL2076227
(1)
|
0 / 0 |