| id | C00019850 |
|---|---|
| Name | Edgeworin |
| CAS RN | 120028-43-5 |
| Standard InChI | InChI=1S/C18H10O6/c19-12-4-1-11-7-16(18(21)24-14(11)8-12)22-13-5-2-10-3-6-17(20)23-15(10)9-13/h1-9,19H |
| Standard InChI (Main Layer) | InChI=1S/C18H10O6/c19-12-4-1-11-7-16(18(21)24-14(11)8-12)22-13-5-2-10-3-6-17(20)23-15(10)9-13/h1-9,19H |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 1906 |
| By standard InChI | CHEMBL259025 |
|---|---|
| By standard InChI Main Layer | CHEMBL259025 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Thymelaeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Edgeworthia chrysantha | 142181 | Thymelaeaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06746 | DNA polymerase beta | Enzyme | CHEMBL259025 |
CHEMBL921744
(1)
CHEMBL921745
(1)
CHEMBL921746 (1) |
0 / 0 |