| id | C00019874 |
|---|---|
| Name | Bakuchicin |
| CAS RN | 4412-93-5 |
| Standard InChI | InChI=1S/C11H6O3/c12-10-4-2-8-9(14-10)3-1-7-5-6-13-11(7)8/h1-6H |
| Standard InChI (Main Layer) | InChI=1S/C11H6O3/c12-10-4-2-8-9(14-10)3-1-7-5-6-13-11(7)8/h1-6H |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 1282 |
| By standard InChI | CHEMBL499847 |
|---|---|
| By standard InChI Main Layer | CHEMBL499847 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Psoralea corylifolia | 429560 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL499847 |
CHEMBL1034330
(1)
|
0 / 0 |