| id | C00019939 |
|---|---|
| Name | (+)-trans-Khellactone |
| CAS RN | 20516-17-0 |
| Standard InChI | InChI=1S/C14H14O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,13,16-17H,1-2H3/t11-,13+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H14O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,13,16-17H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1026 |
| By standard InChI | CHEMBL1452260 |
|---|---|
| By standard InChI Main Layer | CHEMBL68727 CHEMBL72096 CHEMBL129702 CHEMBL479674 CHEMBL1452260 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peucedanum japonicum | 49563 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 | Unclassified protein | CHEMBL1452260 |
CHEMBL1614280
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL72096 CHEMBL1452260 |
CHEMBL1794401
(2)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1452260 |
CHEMBL1738588
(1)
|
0 / 0 |