| id | C00001995 |
|---|---|
| Name | Canthiumine |
| CAS RN | 26195-90-4 |
| Standard InChI | InChI=1S/C33H36N4O4/c1-36(2)28(22-24-10-5-3-6-11-24)32(39)35-29-30(25-12-7-4-8-13-25)41-26-17-15-23(16-18-26)19-20-34-31(38)27-14-9-21-37(27)33(29)40/h3-8,10-13,15-20,27-30H,9,14,21-22H2,1-2H3,(H,34,38)(H,35,39)/b20-19-/t27-,28-,29-,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C33H36N4O4/c1-36(2)28(22-24-10-5-3-6-11-24)32(39)35-29-30(25-12-7-4-8-13-25)41-26-17-15-23(16-18-26)19-20-34-31(38)27-14-9-21-37(27)33(29)40/h3-8,10-13,15-20,27-30H,9,14,21-22H2,1-2H3,(H,34,38)(H,35,39) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 134 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C10000 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Canthium euryoides | 58501 | Rubiaceae | asterids | Viridiplantae |