| id | C00020010 |
|---|---|
| Name | Praeroside IV |
| CAS RN | 117233-34-8 |
| Standard InChI | InChI=1S/C20H24O9/c1-20(2)13(27-19-17(25)16(24)15(23)12(8-21)26-19)7-10-11(29-20)5-3-9-4-6-14(22)28-18(9)10/h3-6,12-13,15-17,19,21,23-25H,7-8H2,1-2H3/t12?,13-,15-,16+,17?,19+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O9/c1-20(2)13(27-19-17(25)16(24)15(23)12(8-21)26-19)7-10-11(29-20)5-3-9-4-6-14(22)28-18(9)10/h3-6,12-13,15-17,19,21,23-25H,7-8H2,1-2H3 |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 399 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1159445 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angelica furcijuga KITAGAWA | 40948 | Apiaceae | asterids | Viridiplantae |
| Peucedanum praeruptorum | 312531 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1159445 |
CHEMBL2114780
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1159445 |
CHEMBL1738588
(1)
|
0 / 0 |