| id | C00020026 |
|---|---|
| Name | Setarin |
| CAS RN | 31005-07-9 |
| Standard InChI | InChI=1S/C12H10O3/c1-2-7-14-11-8-12(13)15-10-6-4-3-5-9(10)11/h2-6,8H,1,7H2 |
| Standard InChI (Main Layer) | InChI=1S/C12H10O3/c1-2-7-14-11-8-12(13)15-10-6-4-3-5-9(10)11/h2-6,8H,1,7H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8136 |
| By standard InChI | CHEMBL1957180 |
|---|---|
| By standard InChI Main Layer | CHEMBL1957180 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Poaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Setaria italica | 4555 | Poaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL1957180 |
CHEMBL1961262
(1)
|
1 / 2 |
| O43570 | Carbonic anhydrase 12 | Lyase | CHEMBL1957180 |
CHEMBL1961264
(1)
|
1 / 2 |
| P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL1957180 |
CHEMBL1961261
(1)
|
0 / 0 |
| Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL1957180 |
CHEMBL1961263
(1)
|
0 / 1 |