| id | C00002042 |
|---|---|
| Name | Girgensonine |
| CAS RN | 486-30-6 |
| Standard InChI | InChI=1S/C13H16N2O/c14-10-13(15-8-2-1-3-9-15)11-4-6-12(16)7-5-11/h4-7,13,16H,1-3,8-9H2 |
| Standard InChI (Main Layer) | InChI=1S/C13H16N2O/c14-10-13(15-8-2-1-3-9-15)11-4-6-12(16)7-5-11/h4-7,13,16H,1-3,8-9H2 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 7267 |
| By standard InChI | CHEMBL1377579 |
|---|---|
| By standard InChI Main Layer | CHEMBL1377579 |
| By LinkDB | C10148 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Amaranthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Girgensohnia oppositifolia | 151223 | Amaranthaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1377579 |
CHEMBL1614458
(1)
|
0 / 0 |