| id | C00002053 | 
|---|---|
| Name | (-)-Lobeline | 
| CAS RN | 90-69-7 | 
| Standard InChI | InChI=1S/C22H27NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-21,24H,8,13-16H2,1H3/t19-,20+,21-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H27NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-21,24H,8,13-16H2,1H3 | 
| Phytochemical cluster | No. 1 | 
|---|---|
| KCF-S cluster | No. 3195 | 
| By standard InChI | CHEMBL122270 | 
|---|---|
| By standard InChI Main Layer | CHEMBL15476 CHEMBL122270 CHEMBL1321415 CHEMBL1371478 CHEMBL1571589 CHEMBL2103769 | 
| By LinkDB | C07475 | 
|---|
| By CAS RN | D008120 | 
|---|
| class name | count | 
|---|---|
| asterids | 6 | 
| family name | count | 
|---|---|
| Campanulaceae | 6 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1321415 CHEMBL1371478 CHEMBL1571589 CHEMBL2103769 | CHEMBL754768
                        (1)
                        CHEMBL1614110
                        (5) CHEMBL1741321 (3) | 1 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL122270 | CHEMBL1794367
                        (1)
                        CHEMBL2114784
                        (1) | 1 / 1 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL122270 | CHEMBL1614544
                        (1) | 11 / 10 | 
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1371478 | CHEMBL1614361
                        (1) | 3 / 2 | 
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL2103769 | CHEMBL2169534
                        (1) | 0 / 0 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1321415 CHEMBL1371478 | CHEMBL1741325
                        (3) | 0 / 1 | 
| P17787 | Neuronal acetylcholine receptor subunit beta-2 | CHRN beta | CHEMBL122270 | CHEMBL1948416
                        (1) | 1 / 1 | 
| P43681 | Neuronal acetylcholine receptor subunit alpha-4 | CHRN alpha | CHEMBL122270 | CHEMBL1948416
                        (1) | 1 / 1 | 
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL122270 | CHEMBL1613800
                        (1) | 0 / 0 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL2103769 | CHEMBL1794486
                        (1) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL2103769 | CHEMBL2114780
                        (1) | 0 / 0 | 
| P36544 | Neuronal acetylcholine receptor subunit alpha-7 | CHRN alpha | CHEMBL122270 | CHEMBL1948415
                        (1) | 0 / 0 | 
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1321415 CHEMBL1371478 | CHEMBL1741322
                        (3) | 0 / 0 | 
| Q05940 | Synaptic vesicular amine transporter | Amine | CHEMBL2103769 | CHEMBL1068127
                        (1) | 0 / 0 | 
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL1371478 | CHEMBL1614274
                        (1)
                        CHEMBL1613823
                        (1) | 0 / 0 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1321415 CHEMBL1371478 | CHEMBL1741323
                        (3) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1321415 CHEMBL1371478 | CHEMBL1741324
                        (3) | 0 / 1 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL122270 | CHEMBL1738442
                        (1) | 0 / 0 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D008120 | 1137 | CHRNA4 BFNC EBN EBN1 NACHR NACHRA4 NACRA4 | cholinergic receptor, nicotinic, alpha 4 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK1 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1137 | CHRNA4 BFNC EBN EBN1 NACHR NACHRA4 NACRA4 | cholinergic receptor, nicotinic, alpha 4 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1137 | CHRNA4 BFNC EBN EBN1 NACHR NACHRA4 NACRA4 | cholinergic receptor, nicotinic, alpha 4 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of STAT3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1137 | CHRNA4 BFNC EBN EBN1 NACHR NACHRA4 NACRA4 | cholinergic receptor, nicotinic, alpha 4 (neuronal) | Lobeline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]] | affects binding / decreases reaction | protein | 14645658 | 
| D008120 | 1137 | CHRNA4 BFNC EBN EBN1 NACHR NACHRA4 NACRA4 | cholinergic receptor, nicotinic, alpha 4 (neuronal) | Lobeline results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein] | affects binding / decreases activity | protein | 14645658 | 
| D008120 | 1139 | CHRNA7 CHRNA7-2 NACHRA7 | cholinergic receptor, nicotinic, alpha 7 (neuronal) | CHRNA7 protein mutant form affects the susceptibility to Lobeline | affects response to substance | protein | 10082212 | 
| D008120 | 1139 | CHRNA7 CHRNA7-2 NACHRA7 | cholinergic receptor, nicotinic, alpha 7 (neuronal) | Lobeline binds to and results in decreased activity of CHRNA7 protein | affects binding / decreases activity | protein | 10082212 | 
| D008120 | 1139 | CHRNA7 CHRNA7-2 NACHRA7 | cholinergic receptor, nicotinic, alpha 7 (neuronal) | Lobeline binds to and results in increased activity of CHRNA7 protein mutant form | affects binding / increases activity | protein | 10082212 | 
| D008120 | 1141 | CHRNB2 EFNL3 nAChRB2 | cholinergic receptor, nicotinic, beta 2 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK1 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1141 | CHRNB2 EFNL3 nAChRB2 | cholinergic receptor, nicotinic, beta 2 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1141 | CHRNB2 EFNL3 nAChRB2 | cholinergic receptor, nicotinic, beta 2 (neuronal) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of STAT3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 1141 | CHRNB2 EFNL3 nAChRB2 | cholinergic receptor, nicotinic, beta 2 (neuronal) | Lobeline inhibits the reaction [epibatidine binds to [CHRNA4 protein binds to CHRNB2 protein]] | affects binding / decreases reaction | protein | 14645658 | 
| D008120 | 1141 | CHRNB2 EFNL3 nAChRB2 | cholinergic receptor, nicotinic, beta 2 (neuronal) | Lobeline results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein] | affects binding / decreases activity | protein | 14645658 | 
| D008120 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK1 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | Lobeline inhibits the reaction [Nicotine results in decreased phosphorylation of MAPK1 protein] | decreases phosphorylation / decreases reaction | protein | 20106947 | 
| D008120 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of MAPK3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | Lobeline inhibits the reaction [Nicotine results in decreased phosphorylation of MAPK3 protein] | decreases phosphorylation / decreases reaction | protein | 20106947 | 
| D008120 | 6774 | STAT3 APRF HIES | signal transducer and activator of transcription 3 (acute-phase response factor) | [Lobeline binds to and results in decreased activity of [CHRNA4 protein binds to CHRNB2 protein]] inhibits the reaction [Nicotine results in increased phosphorylation of STAT3 protein] | affects binding / decreases activity / decreases reaction / increases phosphorylation | protein | 18448488 | 
| D008120 | 6774 | STAT3 APRF HIES | signal transducer and activator of transcription 3 (acute-phase response factor) | Lobeline inhibits the reaction [Nicotine results in increased phosphorylation of STAT3 protein] | decreases reaction / increases phosphorylation | protein | 20106947 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #600513 | Epilepsy, nocturnal frontal lobe, 1; enfl1 | P43681 | 
| #605375 | Epilepsy, nocturnal frontal lobe, 3; enfl3 | P17787 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #603373 | Hyperthyroidism, familial gestational | P16473 | 
| #609152 | Hyperthyroidism, nonautoimmune | P16473 | 
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 | P16473 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P16473
                            (related) | 
| H01269 | Congenital hyperthyroidism | P16473
                            (related) | 
| H00807 | Autosomal dominant nocturnal frontal lobe epilepsy (ADNFLE) | P17787
                            (related) P43681 (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D019969 | D008120 | Amphetamine-Related Disorders | therapeutic | 11408539 | |
| D019970 | D008120 | Cocaine-Related Disorders | therapeutic | 16765386 | |
| D006948 | D008120 | Hyperkinesis | therapeutic | 12479946 | |
| D011595 | D008120 | Psychomotor Agitation | therapeutic | 16765386 | |
| D012640 | D008120 | Seizures | marker/mechanism | 6843794 |