| id | C00020592 |
|---|---|
| Name | Glycyrrhisoflavone |
| CAS RN | 116709-70-7 |
| Standard InChI | InChI=1S/C20H18O6/c1-10(2)3-4-11-5-12(6-16(23)19(11)24)14-9-26-17-8-13(21)7-15(22)18(17)20(14)25/h3,5-9,21-24H,4H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O6/c1-10(2)3-4-11-5-12(6-16(23)19(11)24)14-9-26-17-8-13(21)7-15(22)18(17)20(14)25/h3,5-9,21-24H,4H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL491515 |
|---|---|
| By standard InChI Main Layer | CHEMBL491515 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza glabra | 49827 | Fabaceae | rosids | Viridiplantae |
| Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
| Psorothamnus arborescens | 248527 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL491515 |
CHEMBL1228967
(1)
|
0 / 0 |