| id | C00021069 |
|---|---|
| Name | 6-Deoxychamissonolide |
| CAS RN | 78798-42-2 |
| Standard InChI | InChI=1S/C17H24O5/c1-8-5-12-11(9(2)16(20)22-12)7-17(4)14(19)6-13(15(8)17)21-10(3)18/h8,11-15,19H,2,5-7H2,1,3-4H3/t8-,11-,12-,13+,14-,15-,17-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H24O5/c1-8-5-12-11(9(2)16(20)22-12)7-17(4)14(19)6-13(15(8)17)21-10(3)18/h8,11-15,19H,2,5-7H2,1,3-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 303 |
| By standard InChI | CHEMBL372877 |
|---|---|
| By standard InChI Main Layer | CHEMBL372877 CHEMBL1165403 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arnica chamissonis | 436195 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL372877 |
CHEMBL828644
(1)
|
0 / 0 |
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL372877 |
CHEMBL828644
(1)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL372877 |
CHEMBL828644
(1)
|
0 / 0 |