| id | C00021090 |
|---|---|
| Name | Ergolide / Dihydrobigelovin |
| CAS RN | 54999-07-4 |
| Standard InChI | InChI=1S/C17H22O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h8,11-12,14-15H,2,5-7H2,1,3-4H3/t8-,11+,12+,14-,15+,17+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H22O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h8,11-12,14-15H,2,5-7H2,1,3-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 2862 |
| By standard InChI | CHEMBL515974 |
|---|---|
| By standard InChI Main Layer | CHEMBL515974 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erigeron khorassanicus | 41574 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL515974 |
CHEMBL1008503
(1)
|
0 / 3 |