| id | C00021132 |
|---|---|
| Name | Deacetylisotenulin |
| CAS RN | 13743-85-6 |
| Standard InChI | InChI=1S/C15H20O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7-10,12-13,17H,6H2,1-3H3/t7-,8-,9+,10+,12-,13-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H20O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7-10,12-13,17H,6H2,1-3H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 755 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL309952 CHEMBL354842 CHEMBL188283 CHEMBL1911129 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Helenium bigelovii | 128739 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL188283 |
CHEMBL828644
(1)
CHEMBL861583
(1)
|
0 / 0 |
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL188283 |
CHEMBL828644
(1)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL188283 |
CHEMBL828644
(1)
|
0 / 0 |